4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid

C8H9NO4 — CID 82407404

IUPAC4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid
SMILESCc1cc(CCC(=O)C(=O)O)no1
InChIInChI=1S/C8H9NO4/c1-5-4-6(9-13-5)2-3-7(10)8(11)12/h4H,2-3H2,1H3,(H,11,12)
InChIKeyYZIHQIARHVVUAL-UHFFFAOYSA-N
MW183.16 g/mol
LogP0.57
Rot. Bonds4

About 4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid

4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid (PubChem CID 82407404) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is 4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid.

Molecular Properties

Compound Name4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid
PubChem CID82407404
Molecular FormulaC8H9NO4
Molecular Weight183.16 g/mol
Exact Mass183.05
IUPAC Name4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid
SMILESCc1cc(CCC(=O)C(=O)O)no1
InChIInChI=1S/C8H9NO4/c1-5-4-6(9-13-5)2-3-7(10)8(11)12/h4H,2-3H2,1H3,(H,11,12)
InChIKeyYZIHQIARHVVUAL-UHFFFAOYSA-N
XLogP0.57
TPSA80.40 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.16
LogP ≤ 50.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid?
The IUPAC name of 4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid (CID 82407404) is 4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid.
What is the SMILES notation for 4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid?
The canonical SMILES for 4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid is Cc1cc(CCC(=O)C(=O)O)no1.
What is the InChIKey of 4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid?
The InChIKey is YZIHQIARHVVUAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4/c1-5-4-6(9-13-5)2-3-7(10)8(11)12/h4H,2-3H2,1H3,(H,11,12).
What are the key properties of 4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid?
4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid has a molecular weight of 183.16 g/mol, XLogP of 0.57, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid is sourced from PubChem (CID 82407404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).