C8H9NO4 — CID 82407404
4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid (PubChem CID 82407404) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is 4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid.
| Compound Name | 4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid |
|---|---|
| PubChem CID | 82407404 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 4-(5-methyl-1,2-oxazol-3-yl)-2-oxobutanoic acid |
| SMILES | Cc1cc(CCC(=O)C(=O)O)no1 |
| InChI | InChI=1S/C8H9NO4/c1-5-4-6(9-13-5)2-3-7(10)8(11)12/h4H,2-3H2,1H3,(H,11,12) |
| InChIKey | YZIHQIARHVVUAL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|