C19H23F5O4 — CID 91727539
1-O-heptyl 5-O-[(2,3,4,5,6-pentafluorophenyl)methyl] pentanedioate (PubChem CID 91727539) has the molecular formula C19H23F5O4 and a molecular weight of 410.38 g/mol. Its IUPAC name is 1-O-heptyl 5-O-[(2,3,4,5,6-pentafluorophenyl)methyl] pentanedioate.
| Compound Name | 1-O-heptyl 5-O-[(2,3,4,5,6-pentafluorophenyl)methyl] pentanedioate |
|---|---|
| PubChem CID | 91727539 |
| Molecular Formula | C19H23F5O4 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-O-heptyl 5-O-[(2,3,4,5,6-pentafluorophenyl)methyl] pentanedioate |
| SMILES | CCCCCCCOC(=O)CCCC(=O)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H23F5O4/c1-2-3-4-5-6-10-27-13(25)8-7-9-14(26)28-11-12-15(20)17(22)19(24)18(23)16(12)21/h2-11H2,1H3 |
| InChIKey | YBOMQWLOEUIWEK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|