C21H29BrF2O4 — CID 91708993
5-O-[(4-bromo-2,6-difluorophenyl)methyl] 1-O-nonyl pentanedioate (PubChem CID 91708993) has the molecular formula C21H29BrF2O4 and a molecular weight of 463.36 g/mol. Its IUPAC name is 5-O-[(4-bromo-2,6-difluorophenyl)methyl] 1-O-nonyl pentanedioate.
| Compound Name | 5-O-[(4-bromo-2,6-difluorophenyl)methyl] 1-O-nonyl pentanedioate |
|---|---|
| PubChem CID | 91708993 |
| Molecular Formula | C21H29BrF2O4 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 5-O-[(4-bromo-2,6-difluorophenyl)methyl] 1-O-nonyl pentanedioate |
| SMILES | CCCCCCCCCOC(=O)CCCC(=O)OCc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C21H29BrF2O4/c1-2-3-4-5-6-7-8-12-27-20(25)10-9-11-21(26)28-15-17-18(23)13-16(22)14-19(17)24/h13-14H,2-12,15H2,1H3 |
| InChIKey | XUXSSZODEZAHQB-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|