C18H23F3O4 — CID 91719069
1-O-hexyl 5-O-[(3,4,5-trifluorophenyl)methyl] pentanedioate (PubChem CID 91719069) has the molecular formula C18H23F3O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is 1-O-hexyl 5-O-[(3,4,5-trifluorophenyl)methyl] pentanedioate.
| Compound Name | 1-O-hexyl 5-O-[(3,4,5-trifluorophenyl)methyl] pentanedioate |
|---|---|
| PubChem CID | 91719069 |
| Molecular Formula | C18H23F3O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1-O-hexyl 5-O-[(3,4,5-trifluorophenyl)methyl] pentanedioate |
| SMILES | CCCCCCOC(=O)CCCC(=O)OCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C18H23F3O4/c1-2-3-4-5-9-24-16(22)7-6-8-17(23)25-12-13-10-14(19)18(21)15(20)11-13/h10-11H,2-9,12H2,1H3 |
| InChIKey | PGDZLBVOJCGOLO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|