C27H40F4O3 — CID 141162095
[2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (Z)-octadec-9-enoate (PubChem CID 141162095) has the molecular formula C27H40F4O3 and a molecular weight of 488.61 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (Z)-octadec-9-enoate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 141162095 |
| Molecular Formula | C27H40F4O3 |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCc1c(F)c(F)c(COC)c(F)c1F |
| InChI | InChI=1S/C27H40F4O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(32)34-20-22-26(30)24(28)21(19-33-2)25(29)27(22)31/h10-11H,3-9,12-20H2,1-2H3/b11-10- |
| InChIKey | QQGUSELPVLSYQM-KHPPLWFESA-N |
| XLogP | 8.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|