C27H33F5O2 — CID 101351321
(2,3,4,5,6-pentafluorophenyl)methyl (5Z,8Z,11E,14Z)-icosa-5,8,11,14-tetraenoate (PubChem CID 101351321) has the molecular formula C27H33F5O2 and a molecular weight of 484.55 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl (5Z,8Z,11E,14Z)-icosa-5,8,11,14-tetraenoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl (5Z,8Z,11E,14Z)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 101351321 |
| Molecular Formula | C27H33F5O2 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl (5Z,8Z,11E,14Z)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C/C/C=C\C/C=C\CCCC(=O)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C27H33F5O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(33)34-20-21-23(28)25(30)27(32)26(31)24(21)29/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-20H2,1H3/b7-6-,10-9+,13-12-,16-15- |
| InChIKey | FWWIZVQVBVULSF-MLFLMRJSSA-N |
| XLogP | 8.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|