C10H8F4O2S — CID 14423040
S-[[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl] ethanethioate (PubChem CID 14423040) has the molecular formula C10H8F4O2S and a molecular weight of 268.23 g/mol. Its IUPAC name is S-[[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl] ethanethioate.
| Compound Name | S-[[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl] ethanethioate |
|---|---|
| PubChem CID | 14423040 |
| Molecular Formula | C10H8F4O2S |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | S-[[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl] ethanethioate |
| SMILES | CC(=O)SCc1c(F)c(F)c(CO)c(F)c1F |
| InChI | InChI=1S/C10H8F4O2S/c1-4(16)17-3-6-9(13)7(11)5(2-15)8(12)10(6)14/h15H,2-3H2,1H3 |
| InChIKey | MTGWIXXIMDEXHJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|