C10H8F5NS2 — CID 71371301
(2,3,4,5,6-pentafluorophenyl)methyl N,N-dimethylcarbamodithioate (PubChem CID 71371301) has the molecular formula C10H8F5NS2 and a molecular weight of 301.31 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl N,N-dimethylcarbamodithioate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 71371301 |
| Molecular Formula | C10H8F5NS2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)SCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H8F5NS2/c1-16(2)10(17)18-3-4-5(11)7(13)9(15)8(14)6(4)12/h3H2,1-2H3 |
| InChIKey | SKYVDNGEANPULV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|