C15H4F10S3 — CID 132601048
bis[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]methanethione (PubChem CID 132601048) has the molecular formula C15H4F10S3 and a molecular weight of 470.38 g/mol. Its IUPAC name is bis[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]methanethione.
| Compound Name | bis[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]methanethione |
|---|---|
| PubChem CID | 132601048 |
| Molecular Formula | C15H4F10S3 |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.93 |
| IUPAC Name | bis[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]methanethione |
| SMILES | Fc1c(F)c(F)c(CSC(=S)SCc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C15H4F10S3/c16-5-3(6(17)10(21)13(24)9(5)20)1-27-15(26)28-2-4-7(18)11(22)14(25)12(23)8(4)19/h1-2H2 |
| InChIKey | VPABVKIGLNECMN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|