C14H4F10OS2 — CID 174586735
1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyloxysulfanylmethyl]benzene (PubChem CID 174586735) has the molecular formula C14H4F10OS2 and a molecular weight of 442.30 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyloxysulfanylmethyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyloxysulfanylmethyl]benzene |
|---|---|
| PubChem CID | 174586735 |
| Molecular Formula | C14H4F10OS2 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.95 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyloxysulfanylmethyl]benzene |
| SMILES | Fc1c(F)c(F)c(CSOSCc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C14H4F10OS2/c15-5-3(6(16)10(20)13(23)9(5)19)1-26-25-27-2-4-7(17)11(21)14(24)12(22)8(4)18/h1-2H2 |
| InChIKey | DSRUOZGVOJZGNA-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|