C9H4F8S — CID 87128446
1,2,3,4,5-pentafluoro-6-(2,2,2-trifluoroethylsulfanylmethyl)benzene (PubChem CID 87128446) has the molecular formula C9H4F8S and a molecular weight of 296.18 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(2,2,2-trifluoroethylsulfanylmethyl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(2,2,2-trifluoroethylsulfanylmethyl)benzene |
|---|---|
| PubChem CID | 87128446 |
| Molecular Formula | C9H4F8S |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(2,2,2-trifluoroethylsulfanylmethyl)benzene |
| SMILES | Fc1c(F)c(F)c(CSCC(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C9H4F8S/c10-4-3(1-18-2-9(15,16)17)5(11)7(13)8(14)6(4)12/h1-2H2 |
| InChIKey | LDBOEKKEEVMOOS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|