C13H16F4S — CID 158109063
1-(2,2-dimethylpropylsulfanylmethyl)-2,3,5,6-tetrafluoro-4-methylbenzene (PubChem CID 158109063) has the molecular formula C13H16F4S and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-(2,2-dimethylpropylsulfanylmethyl)-2,3,5,6-tetrafluoro-4-methylbenzene.
| Compound Name | 1-(2,2-dimethylpropylsulfanylmethyl)-2,3,5,6-tetrafluoro-4-methylbenzene |
|---|---|
| PubChem CID | 158109063 |
| Molecular Formula | C13H16F4S |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-(2,2-dimethylpropylsulfanylmethyl)-2,3,5,6-tetrafluoro-4-methylbenzene |
| SMILES | Cc1c(F)c(F)c(CSCC(C)(C)C)c(F)c1F |
| InChI | InChI=1S/C13H16F4S/c1-7-9(14)11(16)8(12(17)10(7)15)5-18-6-13(2,3)4/h5-6H2,1-4H3 |
| InChIKey | OYKRYBJMDRUNFM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|