C17H30F4O4Zr — CID 87558789
tris(propan-1-ol);(2,3,5,6-tetrafluoro-4-methylphenyl)methanol;zirconium (PubChem CID 87558789) has the molecular formula C17H30F4O4Zr and a molecular weight of 465.64 g/mol. Its IUPAC name is tris(propan-1-ol);(2,3,5,6-tetrafluoro-4-methylphenyl)methanol;zirconium.
| Compound Name | tris(propan-1-ol);(2,3,5,6-tetrafluoro-4-methylphenyl)methanol;zirconium |
|---|---|
| PubChem CID | 87558789 |
| Molecular Formula | C17H30F4O4Zr |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | tris(propan-1-ol);(2,3,5,6-tetrafluoro-4-methylphenyl)methanol;zirconium |
| SMILES | CCCO.CCCO.CCCO.Cc1c(F)c(F)c(CO)c(F)c1F.[Zr] |
| InChI | InChI=1S/C8H6F4O.3C3H8O.Zr/c1-3-5(9)7(11)4(2-13)8(12)6(3)10;3*1-2-3-4;/h13H,2H2,1H3;3*4H,2-3H2,1H3; |
| InChIKey | YDLLSUUCCJFYHB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|