C9H7BrF4O — CID 151826929
[4-(2-bromoethyl)-2,3,5,6-tetrafluorophenyl]methanol (PubChem CID 151826929) has the molecular formula C9H7BrF4O and a molecular weight of 287.05 g/mol. Its IUPAC name is [4-(2-bromoethyl)-2,3,5,6-tetrafluorophenyl]methanol.
| Compound Name | [4-(2-bromoethyl)-2,3,5,6-tetrafluorophenyl]methanol |
|---|---|
| PubChem CID | 151826929 |
| Molecular Formula | C9H7BrF4O |
| Molecular Weight | 287.05 g/mol |
| Exact Mass | 285.96 |
| IUPAC Name | [4-(2-bromoethyl)-2,3,5,6-tetrafluorophenyl]methanol |
| SMILES | OCc1c(F)c(F)c(CCBr)c(F)c1F |
| InChI | InChI=1S/C9H7BrF4O/c10-2-1-4-6(11)8(13)5(3-15)9(14)7(4)12/h15H,1-3H2 |
| InChIKey | SDUXGALNEWSIBR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.05 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|