C10H6F4O — CID 11435909
(2,3,5,6-tetrafluoro-4-prop-2-ynylphenyl)methanol (PubChem CID 11435909) has the molecular formula C10H6F4O and a molecular weight of 218.15 g/mol. Its IUPAC name is (2,3,5,6-tetrafluoro-4-prop-2-ynylphenyl)methanol.
| Compound Name | (2,3,5,6-tetrafluoro-4-prop-2-ynylphenyl)methanol |
|---|---|
| PubChem CID | 11435909 |
| Molecular Formula | C10H6F4O |
| Molecular Weight | 218.15 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | (2,3,5,6-tetrafluoro-4-prop-2-ynylphenyl)methanol |
| SMILES | C#CCc1c(F)c(F)c(CO)c(F)c1F |
| InChI | InChI=1S/C10H6F4O/c1-2-3-5-7(11)9(13)6(4-15)10(14)8(5)12/h1,15H,3-4H2 |
| InChIKey | HSWOILMZLAARCG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.15 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|