C26H5BF19- — CID 158705249
bis(2,3,4,5,6-pentafluorophenyl)-[(2,3,4,5,6-pentafluorophenyl)methyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)boranuide (PubChem CID 158705249) has the molecular formula C26H5BF19- and a molecular weight of 689.10 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-[(2,3,4,5,6-pentafluorophenyl)methyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)boranuide.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-[(2,3,4,5,6-pentafluorophenyl)methyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)boranuide |
|---|---|
| PubChem CID | 158705249 |
| Molecular Formula | C26H5BF19- |
| Molecular Weight | 689.10 g/mol |
| Exact Mass | 689.02 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-[(2,3,4,5,6-pentafluorophenyl)methyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)boranuide |
| SMILES | Cc1c(F)c(F)c([B-](Cc2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C26H5BF19/c1-3-8(28)12(32)5(13(33)9(3)29)27(6-14(34)20(40)25(45)21(41)15(6)35,7-16(36)22(42)26(46)23(43)17(7)37)2-4-10(30)18(38)24(44)19(39)11(4)31/h2H2,1H3/q-1 |
| InChIKey | UNZQQAWGZPOASE-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.10 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|