C10H11F5O — CID 142404647
ethane;formaldehyde;1,2,3,4,5-pentafluoro-6-methylbenzene (PubChem CID 142404647) has the molecular formula C10H11F5O and a molecular weight of 242.19 g/mol. Its IUPAC name is ethane;formaldehyde;1,2,3,4,5-pentafluoro-6-methylbenzene.
| Compound Name | ethane;formaldehyde;1,2,3,4,5-pentafluoro-6-methylbenzene |
|---|---|
| PubChem CID | 142404647 |
| Molecular Formula | C10H11F5O |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | ethane;formaldehyde;1,2,3,4,5-pentafluoro-6-methylbenzene |
| SMILES | C=O.CC.Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7H3F5.C2H6.CH2O/c1-2-3(8)5(10)7(12)6(11)4(2)9;2*1-2/h1H3;1-2H3;1H2 |
| InChIKey | LOZFPMXINOBZHZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|