C8H8F3N — CID 23359007
2,4,5-trifluoro-3,6-dimethylaniline (PubChem CID 23359007) has the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. Its IUPAC name is 2,4,5-trifluoro-3,6-dimethylaniline.
| Compound Name | 2,4,5-trifluoro-3,6-dimethylaniline |
|---|---|
| PubChem CID | 23359007 |
| Molecular Formula | C8H8F3N |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 2,4,5-trifluoro-3,6-dimethylaniline |
| SMILES | Cc1c(N)c(F)c(C)c(F)c1F |
| InChI | InChI=1S/C8H8F3N/c1-3-5(9)6(10)4(2)8(12)7(3)11/h12H2,1-2H3 |
| InChIKey | FFISVCIYPFSVDX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|