C25H4BF18- — CID 162205470
bis(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-methylphenyl)-(2,3,4,6-tetrafluorophenyl)boranuide (PubChem CID 162205470) has the molecular formula C25H4BF18- and a molecular weight of 657.08 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-methylphenyl)-(2,3,4,6-tetrafluorophenyl)boranuide.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-methylphenyl)-(2,3,4,6-tetrafluorophenyl)boranuide |
|---|---|
| PubChem CID | 162205470 |
| Molecular Formula | C25H4BF18- |
| Molecular Weight | 657.08 g/mol |
| Exact Mass | 657.01 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-methylphenyl)-(2,3,4,6-tetrafluorophenyl)boranuide |
| SMILES | Cc1c(F)c(F)c([B-](c2c(F)cc(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C25H4BF18/c1-3-10(29)14(33)7(15(34)11(3)30)26(6-4(27)2-5(28)12(31)13(6)32,8-16(35)20(39)24(43)21(40)17(8)36)9-18(37)22(41)25(44)23(42)19(9)38/h2H,1H3/q-1 |
| InChIKey | XIGFOSRGULCSBT-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.08 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|