C54H39BF20Sn — CID 10909361
tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris(2,3,5,6-tetramethylphenyl)stannanylium (PubChem CID 10909361) has the molecular formula C54H39BF20Sn and a molecular weight of 1197.39 g/mol. Its IUPAC name is tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris(2,3,5,6-tetramethylphenyl)stannanylium.
| Compound Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris(2,3,5,6-tetramethylphenyl)stannanylium |
|---|---|
| PubChem CID | 10909361 |
| Molecular Formula | C54H39BF20Sn |
| Molecular Weight | 1197.39 g/mol |
| Exact Mass | 1198.18 |
| IUPAC Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris(2,3,5,6-tetramethylphenyl)stannanylium |
| SMILES | Cc1cc(C)c(C)c([Sn+](c2c(C)c(C)cc(C)c2C)c2c(C)c(C)cc(C)c2C)c1C.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.3C10H13.Sn/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;3*1-7-5-9(3)10(4)6-8(7)2;/h;3*5H,1-4H3;/q-1;;;;+1 |
| InChIKey | WTHCQRLTDMOZQY-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1197.39 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|