C24H2BF20- — CID 158708650
tris(2,3,4,5,6-pentafluorophenyl)-(2,3,4,5-tetrafluorophenyl)boranuide;hydrofluoride (PubChem CID 158708650) has the molecular formula C24H2BF20- and a molecular weight of 681.05 g/mol. Its IUPAC name is tris(2,3,4,5,6-pentafluorophenyl)-(2,3,4,5-tetrafluorophenyl)boranuide;hydrofluoride.
| Compound Name | tris(2,3,4,5,6-pentafluorophenyl)-(2,3,4,5-tetrafluorophenyl)boranuide;hydrofluoride |
|---|---|
| PubChem CID | 158708650 |
| Molecular Formula | C24H2BF20- |
| Molecular Weight | 681.05 g/mol |
| Exact Mass | 680.99 |
| IUPAC Name | tris(2,3,4,5,6-pentafluorophenyl)-(2,3,4,5-tetrafluorophenyl)boranuide;hydrofluoride |
| SMILES | F.Fc1cc([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c(F)c1F |
| InChI | InChI=1S/C24HBF19.FH/c26-3-1-2(7(27)15(35)8(3)28)25(4-9(29)16(36)22(42)17(37)10(4)30,5-11(31)18(38)23(43)19(39)12(5)32)6-13(33)20(40)24(44)21(41)14(6)34;/h1H;1H/q-1; |
| InChIKey | IILBXQMZPCQELQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.05 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|