C29H9BF16O — CID 139908120
pyrylium;tetrakis(2,3,4,5-tetrafluorophenyl)boranuide (PubChem CID 139908120) has the molecular formula C29H9BF16O and a molecular weight of 688.17 g/mol. Its IUPAC name is pyrylium;tetrakis(2,3,4,5-tetrafluorophenyl)boranuide.
| Compound Name | pyrylium;tetrakis(2,3,4,5-tetrafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139908120 |
| Molecular Formula | C29H9BF16O |
| Molecular Weight | 688.17 g/mol |
| Exact Mass | 688.05 |
| IUPAC Name | pyrylium;tetrakis(2,3,4,5-tetrafluorophenyl)boranuide |
| SMILES | Fc1cc([B-](c2cc(F)c(F)c(F)c2F)(c2cc(F)c(F)c(F)c2F)c2cc(F)c(F)c(F)c2F)c(F)c(F)c1F.c1cc[o+]cc1 |
| InChI | InChI=1S/C24H4BF16.C5H5O/c26-9-1-5(13(30)21(38)17(9)34)25(6-2-10(27)18(35)22(39)14(6)31,7-3-11(28)19(36)23(40)15(7)32)8-4-12(29)20(37)24(41)16(8)33;1-2-4-6-5-3-1/h1-4H;1-5H/q-1;+1 |
| InChIKey | KVTBLUOVNSBWFE-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.17 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|