C6H4AgBF5O3 — CID 159886582
boric acid;1,2,3,4,5-pentafluorobenzene;silver (PubChem CID 159886582) has the molecular formula C6H4AgBF5O3 and a molecular weight of 337.77 g/mol. Its IUPAC name is boric acid;1,2,3,4,5-pentafluorobenzene;silver.
| Compound Name | boric acid;1,2,3,4,5-pentafluorobenzene;silver |
|---|---|
| PubChem CID | 159886582 |
| Molecular Formula | C6H4AgBF5O3 |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 336.92 |
| IUPAC Name | boric acid;1,2,3,4,5-pentafluorobenzene;silver |
| SMILES | Fc1cc(F)c(F)c(F)c1F.OB(O)O.[Ag] |
| InChI | InChI=1S/C6HF5.Ag.BH3O3/c7-2-1-3(8)5(10)6(11)4(2)9;;2-1(3)4/h1H;;2-4H |
| InChIKey | NUFDTSWNYJPFCI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|