C10H16BF5NO3+ — CID 159111301
boric acid;1,2,3,4,5-pentafluorobenzene;tetramethylazanium (PubChem CID 159111301) has the molecular formula C10H16BF5NO3+ and a molecular weight of 304.04 g/mol. Its IUPAC name is boric acid;1,2,3,4,5-pentafluorobenzene;tetramethylazanium.
| Compound Name | boric acid;1,2,3,4,5-pentafluorobenzene;tetramethylazanium |
|---|---|
| PubChem CID | 159111301 |
| Molecular Formula | C10H16BF5NO3+ |
| Molecular Weight | 304.04 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | boric acid;1,2,3,4,5-pentafluorobenzene;tetramethylazanium |
| SMILES | C[N+](C)(C)C.Fc1cc(F)c(F)c(F)c1F.OB(O)O |
| InChI | InChI=1S/C6HF5.C4H12N.BH3O3/c7-2-1-3(8)5(10)6(11)4(2)9;1-5(2,3)4;2-1(3)4/h1H;1-4H3;2-4H/q;+1; |
| InChIKey | KENJREHSLKLPKE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.04 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|