C14H15BF5NO3 — CID 161264040
boric acid;N,N-dimethylaniline;1,2,3,4,5-pentafluorobenzene (PubChem CID 161264040) has the molecular formula C14H15BF5NO3 and a molecular weight of 351.08 g/mol. Its IUPAC name is boric acid;N,N-dimethylaniline;1,2,3,4,5-pentafluorobenzene.
| Compound Name | boric acid;N,N-dimethylaniline;1,2,3,4,5-pentafluorobenzene |
|---|---|
| PubChem CID | 161264040 |
| Molecular Formula | C14H15BF5NO3 |
| Molecular Weight | 351.08 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | boric acid;N,N-dimethylaniline;1,2,3,4,5-pentafluorobenzene |
| SMILES | CN(C)c1ccccc1.Fc1cc(F)c(F)c(F)c1F.OB(O)O |
| InChI | InChI=1S/C8H11N.C6HF5.BH3O3/c1-9(2)8-6-4-3-5-7-8;7-2-1-3(8)5(10)6(11)4(2)9;2-1(3)4/h3-7H,1-2H3;1H;2-4H |
| InChIKey | VCXXLBULNSFKQS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.08 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|