C20H12BF10NO3 — CID 162232157
bis(2,3,4,5,6-pentafluorophenoxy)borinic acid;N,N-dimethylaniline (PubChem CID 162232157) has the molecular formula C20H12BF10NO3 and a molecular weight of 515.11 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenoxy)borinic acid;N,N-dimethylaniline.
| Compound Name | bis(2,3,4,5,6-pentafluorophenoxy)borinic acid;N,N-dimethylaniline |
|---|---|
| PubChem CID | 162232157 |
| Molecular Formula | C20H12BF10NO3 |
| Molecular Weight | 515.11 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenoxy)borinic acid;N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1.OB(Oc1c(F)c(F)c(F)c(F)c1F)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12HBF10O3.C8H11N/c14-1-3(16)7(20)11(8(21)4(1)17)25-13(24)26-12-9(22)5(18)2(15)6(19)10(12)23;1-9(2)8-6-4-3-5-7-8/h24H;3-7H,1-2H3 |
| InChIKey | ZVONBDOFBGCJEJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.11 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|