C14H11AlF5N+2 — CID 172730033
N,N-dimethylaniline;(2,3,4,5,6-pentafluorophenyl)aluminum(2+) (PubChem CID 172730033) has the molecular formula C14H11AlF5N+2 and a molecular weight of 315.22 g/mol. Its IUPAC name is N,N-dimethylaniline;(2,3,4,5,6-pentafluorophenyl)aluminum(2+).
| Compound Name | N,N-dimethylaniline;(2,3,4,5,6-pentafluorophenyl)aluminum(2+) |
|---|---|
| PubChem CID | 172730033 |
| Molecular Formula | C14H11AlF5N+2 |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N,N-dimethylaniline;(2,3,4,5,6-pentafluorophenyl)aluminum(2+) |
| SMILES | CN(C)c1ccccc1.Fc1c(F)c(F)c([Al+2])c(F)c1F |
| InChI | InChI=1S/C8H11N.C6F5.Al/c1-9(2)8-6-4-3-5-7-8;7-2-1-3(8)5(10)6(11)4(2)9;/h3-7H,1-2H3;;/q;;+2 |
| InChIKey | HQZYYUCRBQTKCK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|