About hydron;tetrakis(2,3-difluorophenyl)boranuide
hydron;tetrakis(2,3-difluorophenyl)boranuide (PubChem CID 140553745) has the molecular formula C24H13BF8
and a molecular weight of 464.16 g/mol. Its IUPAC name is hydron;tetrakis(2,3-difluorophenyl)boranuide.
Molecular Properties
| Compound Name | hydron;tetrakis(2,3-difluorophenyl)boranuide |
| PubChem CID | 140553745 |
| Molecular Formula | C24H13BF8 |
| Molecular Weight | 464.16 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | hydron;tetrakis(2,3-difluorophenyl)boranuide |
| SMILES | Fc1cccc([B-](c2cccc(F)c2F)(c2cccc(F)c2F)c2cccc(F)c2F)c1F.[H+] |
| InChI | InChI=1S/C24H12BF8/c26-17-9-1-5-13(21(17)30)25(14-6-2-10-18(27)22(14)31,15-7-3-11-19(28)23(15)32)16-8-4-12-20(29)24(16)33/h1-12H/q-1/p+1 |
| InChIKey | MCYPJCZCCZUJJI-UHFFFAOYSA-O |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.16 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hydron;tetrakis(2,3-difluorophenyl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;tetrakis(2,3-difluorophenyl)boranuide?
The IUPAC name of hydron;tetrakis(2,3-difluorophenyl)boranuide (CID 140553745) is hydron;tetrakis(2,3-difluorophenyl)boranuide.
What is the SMILES notation for hydron;tetrakis(2,3-difluorophenyl)boranuide?
The canonical SMILES for hydron;tetrakis(2,3-difluorophenyl)boranuide is Fc1cccc([B-](c2cccc(F)c2F)(c2cccc(F)c2F)c2cccc(F)c2F)c1F.[H+].
What is the InChIKey of hydron;tetrakis(2,3-difluorophenyl)boranuide?
The InChIKey is MCYPJCZCCZUJJI-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H12BF8/c26-17-9-1-5-13(21(17)30)25(14-6-2-10-18(27)22(14)31,15-7-3-11-19(28)23(15)32)16-8-4-12-20(29)24(16)33/h1-12H/q-1/p+1.
What are the key properties of hydron;tetrakis(2,3-difluorophenyl)boranuide?
hydron;tetrakis(2,3-difluorophenyl)boranuide has a molecular weight of 464.16 g/mol, XLogP of 4.29, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;tetrakis(2,3-difluorophenyl)boranuide is sourced from PubChem (CID 140553745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).