C10H8F3N — CID 175102094
1H-pyrrole;1,2,3-trifluorobenzene (PubChem CID 175102094) has the molecular formula C10H8F3N and a molecular weight of 199.18 g/mol. Its IUPAC name is 1H-pyrrole;1,2,3-trifluorobenzene.
| Compound Name | 1H-pyrrole;1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 175102094 |
| Molecular Formula | C10H8F3N |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 1H-pyrrole;1,2,3-trifluorobenzene |
| SMILES | Fc1cccc(F)c1F.c1cc[nH]c1 |
| InChI | InChI=1S/C6H3F3.C4H5N/c7-4-2-1-3-5(8)6(4)9;1-2-4-5-3-1/h1-3H;1-5H |
| InChIKey | SIOYQNKWLMTVSO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|