C11H11F4N — CID 175290813
methane;1H-pyrrole;1,2,3,4-tetrafluorobenzene (PubChem CID 175290813) has the molecular formula C11H11F4N and a molecular weight of 233.21 g/mol. Its IUPAC name is methane;1H-pyrrole;1,2,3,4-tetrafluorobenzene.
| Compound Name | methane;1H-pyrrole;1,2,3,4-tetrafluorobenzene |
|---|---|
| PubChem CID | 175290813 |
| Molecular Formula | C11H11F4N |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | methane;1H-pyrrole;1,2,3,4-tetrafluorobenzene |
| SMILES | C.Fc1ccc(F)c(F)c1F.c1cc[nH]c1 |
| InChI | InChI=1S/C6H2F4.C4H5N.CH4/c7-3-1-2-4(8)6(10)5(3)9;1-2-4-5-3-1;/h1-2H;1-5H;1H4 |
| InChIKey | GGLVSRATTQQVKQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|