C22H11BF9NO3 — CID 172826277
1H-pyrrole;tris(2,3,6-trifluorophenyl) borate (PubChem CID 172826277) has the molecular formula C22H11BF9NO3 and a molecular weight of 519.13 g/mol. Its IUPAC name is 1H-pyrrole;tris(2,3,6-trifluorophenyl) borate.
| Compound Name | 1H-pyrrole;tris(2,3,6-trifluorophenyl) borate |
|---|---|
| PubChem CID | 172826277 |
| Molecular Formula | C22H11BF9NO3 |
| Molecular Weight | 519.13 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 1H-pyrrole;tris(2,3,6-trifluorophenyl) borate |
| SMILES | Fc1ccc(F)c(OB(Oc2c(F)ccc(F)c2F)Oc2c(F)ccc(F)c2F)c1F.c1cc[nH]c1 |
| InChI | InChI=1S/C18H6BF9O3.C4H5N/c20-7-1-4-10(23)16(13(7)26)29-19(30-17-11(24)5-2-8(21)14(17)27)31-18-12(25)6-3-9(22)15(18)28;1-2-4-5-3-1/h1-6H;1-5H |
| InChIKey | UXERDSOLJIJOBP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.13 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|