C8H9F2NO — CID 22118017
2-ethoxy-3,4-difluoroaniline (PubChem CID 22118017) has the molecular formula C8H9F2NO and a molecular weight of 173.16 g/mol. Its IUPAC name is 2-ethoxy-3,4-difluoroaniline.
| Compound Name | 2-ethoxy-3,4-difluoroaniline |
|---|---|
| PubChem CID | 22118017 |
| Molecular Formula | C8H9F2NO |
| Molecular Weight | 173.16 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 2-ethoxy-3,4-difluoroaniline |
| SMILES | CCOc1c(N)ccc(F)c1F |
| InChI | InChI=1S/C8H9F2NO/c1-2-12-8-6(11)4-3-5(9)7(8)10/h3-4H,2,11H2,1H3 |
| InChIKey | NUOCJEKHYYUWSR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.16 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|