C12H18F2N2O — CID 62533946
2-[2-(diethylamino)ethoxy]-3,4-difluoroaniline (PubChem CID 62533946) has the molecular formula C12H18F2N2O and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethoxy]-3,4-difluoroaniline.
| Compound Name | 2-[2-(diethylamino)ethoxy]-3,4-difluoroaniline |
|---|---|
| PubChem CID | 62533946 |
| Molecular Formula | C12H18F2N2O |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 2-[2-(diethylamino)ethoxy]-3,4-difluoroaniline |
| SMILES | CCN(CC)CCOc1c(N)ccc(F)c1F |
| InChI | InChI=1S/C12H18F2N2O/c1-3-16(4-2)7-8-17-12-10(15)6-5-9(13)11(12)14/h5-6H,3-4,7-8,15H2,1-2H3 |
| InChIKey | QKIGECLLTMKYJV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|