C15H25F2N3 — CID 102991239
2-N-[3-(diethylamino)propyl]-2-N-ethyl-3,4-difluorobenzene-1,2-diamine (PubChem CID 102991239) has the molecular formula C15H25F2N3 and a molecular weight of 285.38 g/mol. Its IUPAC name is 2-N-[3-(diethylamino)propyl]-2-N-ethyl-3,4-difluorobenzene-1,2-diamine.
| Compound Name | 2-N-[3-(diethylamino)propyl]-2-N-ethyl-3,4-difluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 102991239 |
| Molecular Formula | C15H25F2N3 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 2-N-[3-(diethylamino)propyl]-2-N-ethyl-3,4-difluorobenzene-1,2-diamine |
| SMILES | CCN(CC)CCCN(CC)c1c(N)ccc(F)c1F |
| InChI | InChI=1S/C15H25F2N3/c1-4-19(5-2)10-7-11-20(6-3)15-13(18)9-8-12(16)14(15)17/h8-9H,4-7,10-11,18H2,1-3H3 |
| InChIKey | PLTQUHUSWIWTQE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|