C15H25BrFN3 — CID 102991268
4-bromo-1-N-[3-(diethylamino)propyl]-1-N-ethyl-5-fluorobenzene-1,2-diamine (PubChem CID 102991268) has the molecular formula C15H25BrFN3 and a molecular weight of 346.29 g/mol. Its IUPAC name is 4-bromo-1-N-[3-(diethylamino)propyl]-1-N-ethyl-5-fluorobenzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-[3-(diethylamino)propyl]-1-N-ethyl-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 102991268 |
| Molecular Formula | C15H25BrFN3 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 4-bromo-1-N-[3-(diethylamino)propyl]-1-N-ethyl-5-fluorobenzene-1,2-diamine |
| SMILES | CCN(CC)CCCN(CC)c1cc(F)c(Br)cc1N |
| InChI | InChI=1S/C15H25BrFN3/c1-4-19(5-2)8-7-9-20(6-3)15-11-13(17)12(16)10-14(15)18/h10-11H,4-9,18H2,1-3H3 |
| InChIKey | XDMQOFDPYWTWKG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|