C12H17FN2O3 — CID 113468587
5-amino-4-[ethyl(3-hydroxypropyl)amino]-2-fluorobenzoic acid (PubChem CID 113468587) has the molecular formula C12H17FN2O3 and a molecular weight of 256.28 g/mol. Its IUPAC name is 5-amino-4-[ethyl(3-hydroxypropyl)amino]-2-fluorobenzoic acid.
| Compound Name | 5-amino-4-[ethyl(3-hydroxypropyl)amino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 113468587 |
| Molecular Formula | C12H17FN2O3 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 5-amino-4-[ethyl(3-hydroxypropyl)amino]-2-fluorobenzoic acid |
| SMILES | CCN(CCCO)c1cc(F)c(C(=O)O)cc1N |
| InChI | InChI=1S/C12H17FN2O3/c1-2-15(4-3-5-16)11-7-9(13)8(12(17)18)6-10(11)14/h6-7,16H,2-5,14H2,1H3,(H,17,18) |
| InChIKey | BOPLLVSLGLNNAI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|