C14H13BrF2N2 — CID 66110346
4-bromo-1-N-ethyl-5-fluoro-1-N-(4-fluorophenyl)benzene-1,2-diamine (PubChem CID 66110346) has the molecular formula C14H13BrF2N2 and a molecular weight of 327.17 g/mol. Its IUPAC name is 4-bromo-1-N-ethyl-5-fluoro-1-N-(4-fluorophenyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-ethyl-5-fluoro-1-N-(4-fluorophenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 66110346 |
| Molecular Formula | C14H13BrF2N2 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 4-bromo-1-N-ethyl-5-fluoro-1-N-(4-fluorophenyl)benzene-1,2-diamine |
| SMILES | CCN(c1ccc(F)cc1)c1cc(F)c(Br)cc1N |
| InChI | InChI=1S/C14H13BrF2N2/c1-2-19(10-5-3-9(16)4-6-10)14-8-12(17)11(15)7-13(14)18/h3-8H,2,18H2,1H3 |
| InChIKey | UDWOKAXWUWVXNO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|