C11H13BrF4N2 — CID 66109551
4-bromo-5-fluoro-1-N-propyl-1-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine (PubChem CID 66109551) has the molecular formula C11H13BrF4N2 and a molecular weight of 329.14 g/mol. Its IUPAC name is 4-bromo-5-fluoro-1-N-propyl-1-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-5-fluoro-1-N-propyl-1-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 66109551 |
| Molecular Formula | C11H13BrF4N2 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 4-bromo-5-fluoro-1-N-propyl-1-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine |
| SMILES | CCCN(CC(F)(F)F)c1cc(F)c(Br)cc1N |
| InChI | InChI=1S/C11H13BrF4N2/c1-2-3-18(6-11(14,15)16)10-5-8(13)7(12)4-9(10)17/h4-5H,2-3,6,17H2,1H3 |
| InChIKey | AYMXYJXNHZCMKK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|