C12H16BrF2N — CID 107612880
4-bromo-2,5-difluoro-N,N-dipropylaniline (PubChem CID 107612880) has the molecular formula C12H16BrF2N and a molecular weight of 292.17 g/mol. Its IUPAC name is 4-bromo-2,5-difluoro-N,N-dipropylaniline.
| Compound Name | 4-bromo-2,5-difluoro-N,N-dipropylaniline |
|---|---|
| PubChem CID | 107612880 |
| Molecular Formula | C12H16BrF2N |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 4-bromo-2,5-difluoro-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C12H16BrF2N/c1-3-5-16(6-4-2)12-8-10(14)9(13)7-11(12)15/h7-8H,3-6H2,1-2H3 |
| InChIKey | WVDVHSBYXJNJBM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|