C16H27FN2 — CID 84753345
2-fluoro-5-[(propan-2-ylamino)methyl]-N,N-dipropylaniline (PubChem CID 84753345) has the molecular formula C16H27FN2 and a molecular weight of 266.40 g/mol. Its IUPAC name is 2-fluoro-5-[(propan-2-ylamino)methyl]-N,N-dipropylaniline.
| Compound Name | 2-fluoro-5-[(propan-2-ylamino)methyl]-N,N-dipropylaniline |
|---|---|
| PubChem CID | 84753345 |
| Molecular Formula | C16H27FN2 |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 2-fluoro-5-[(propan-2-ylamino)methyl]-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1cc(CNC(C)C)ccc1F |
| InChI | InChI=1S/C16H27FN2/c1-5-9-19(10-6-2)16-11-14(7-8-15(16)17)12-18-13(3)4/h7-8,11,13,18H,5-6,9-10,12H2,1-4H3 |
| InChIKey | LOBYTCYFCMAORZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |