C12H14FN — CID 130535101
N-[(3-ethynyl-4-fluorophenyl)methyl]propan-2-amine (PubChem CID 130535101) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is N-[(3-ethynyl-4-fluorophenyl)methyl]propan-2-amine.
| Compound Name | N-[(3-ethynyl-4-fluorophenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 130535101 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | N-[(3-ethynyl-4-fluorophenyl)methyl]propan-2-amine |
| SMILES | C#Cc1cc(CNC(C)C)ccc1F |
| InChI | InChI=1S/C12H14FN/c1-4-11-7-10(5-6-12(11)13)8-14-9(2)3/h1,5-7,9,14H,8H2,2-3H3 |
| InChIKey | JSYVPNCGVYSPGV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|