C11H11BrF4N2 — CID 116735744
4-bromo-2-N-cyclopropyl-5-fluoro-2-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine (PubChem CID 116735744) has the molecular formula C11H11BrF4N2 and a molecular weight of 327.12 g/mol. Its IUPAC name is 4-bromo-2-N-cyclopropyl-5-fluoro-2-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-cyclopropyl-5-fluoro-2-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 116735744 |
| Molecular Formula | C11H11BrF4N2 |
| Molecular Weight | 327.12 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 4-bromo-2-N-cyclopropyl-5-fluoro-2-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine |
| SMILES | Nc1cc(F)c(Br)cc1N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C11H11BrF4N2/c12-7-3-10(9(17)4-8(7)13)18(6-1-2-6)5-11(14,15)16/h3-4,6H,1-2,5,17H2 |
| InChIKey | GFALNNUOHGUEOW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.12 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|