C12H11BrF4N2S — CID 107534949
2-bromo-4-[cyclopropyl(2,2,2-trifluoroethyl)amino]-3-fluorobenzenecarbothioamide (PubChem CID 107534949) has the molecular formula C12H11BrF4N2S and a molecular weight of 371.20 g/mol. Its IUPAC name is 2-bromo-4-[cyclopropyl(2,2,2-trifluoroethyl)amino]-3-fluorobenzenecarbothioamide.
| Compound Name | 2-bromo-4-[cyclopropyl(2,2,2-trifluoroethyl)amino]-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107534949 |
| Molecular Formula | C12H11BrF4N2S |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 2-bromo-4-[cyclopropyl(2,2,2-trifluoroethyl)amino]-3-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N(CC(F)(F)F)C2CC2)c(F)c1Br |
| InChI | InChI=1S/C12H11BrF4N2S/c13-9-7(11(18)20)3-4-8(10(9)14)19(6-1-2-6)5-12(15,16)17/h3-4,6H,1-2,5H2,(H2,18,20) |
| InChIKey | NXWBVDSMBJTCRS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|