C12H16BrFN2S2 — CID 114237268
2-bromo-3-fluoro-4-[methyl(3-methylsulfanylpropyl)amino]benzenecarbothioamide (PubChem CID 114237268) has the molecular formula C12H16BrFN2S2 and a molecular weight of 351.31 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[methyl(3-methylsulfanylpropyl)amino]benzenecarbothioamide.
| Compound Name | 2-bromo-3-fluoro-4-[methyl(3-methylsulfanylpropyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114237268 |
| Molecular Formula | C12H16BrFN2S2 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 2-bromo-3-fluoro-4-[methyl(3-methylsulfanylpropyl)amino]benzenecarbothioamide |
| SMILES | CSCCCN(C)c1ccc(C(N)=S)c(Br)c1F |
| InChI | InChI=1S/C12H16BrFN2S2/c1-16(6-3-7-18-2)9-5-4-8(12(15)17)10(13)11(9)14/h4-5H,3,6-7H2,1-2H3,(H2,15,17) |
| InChIKey | ZUUNYQPBUGUHGS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|