C14H11BrF2N2S — CID 107535021
2-bromo-3-fluoro-4-(3-fluoro-N-methylanilino)benzenecarbothioamide (PubChem CID 107535021) has the molecular formula C14H11BrF2N2S and a molecular weight of 357.22 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-(3-fluoro-N-methylanilino)benzenecarbothioamide.
| Compound Name | 2-bromo-3-fluoro-4-(3-fluoro-N-methylanilino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107535021 |
| Molecular Formula | C14H11BrF2N2S |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 2-bromo-3-fluoro-4-(3-fluoro-N-methylanilino)benzenecarbothioamide |
| SMILES | CN(c1cccc(F)c1)c1ccc(C(N)=S)c(Br)c1F |
| InChI | InChI=1S/C14H11BrF2N2S/c1-19(9-4-2-3-8(16)7-9)11-6-5-10(14(18)20)12(15)13(11)17/h2-7H,1H3,(H2,18,20) |
| InChIKey | LZHXLPOPIDDKKS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|