C16H16BrFN2S — CID 107535014
2-bromo-3-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide (PubChem CID 107535014) has the molecular formula C16H16BrFN2S and a molecular weight of 367.29 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide.
| Compound Name | 2-bromo-3-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107535014 |
| Molecular Formula | C16H16BrFN2S |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 2-bromo-3-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide |
| SMILES | Cc1cc(C)cc(N(C)c2ccc(C(N)=S)c(Br)c2F)c1 |
| InChI | InChI=1S/C16H16BrFN2S/c1-9-6-10(2)8-11(7-9)20(3)13-5-4-12(16(19)21)14(17)15(13)18/h4-8H,1-3H3,(H2,19,21) |
| InChIKey | GXIMWILQTVBBSV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|