About 2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide
2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide (PubChem CID 115368225) has the molecular formula C16H17FN2S
and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide.
Molecular Properties
| Compound Name | 2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide |
| PubChem CID | 115368225 |
| Molecular Formula | C16H17FN2S |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide |
| SMILES | Cc1cc(C)cc(N(C)c2ccc(C(N)=S)c(F)c2)c1 |
| InChI | InChI=1S/C16H17FN2S/c1-10-6-11(2)8-13(7-10)19(3)12-4-5-14(16(18)20)15(17)9-12/h4-9H,1-3H3,(H2,18,20) |
| InChIKey | NZRWLMCNBADSMQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide?
The IUPAC name of 2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide (CID 115368225) is 2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide.
What is the SMILES notation for 2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide?
The canonical SMILES for 2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide is Cc1cc(C)cc(N(C)c2ccc(C(N)=S)c(F)c2)c1.
What is the InChIKey of 2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide?
The InChIKey is NZRWLMCNBADSMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN2S/c1-10-6-11(2)8-13(7-10)19(3)12-4-5-14(16(18)20)15(17)9-12/h4-9H,1-3H3,(H2,18,20).
What are the key properties of 2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide?
2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide has a molecular weight of 288.39 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-(N,3,5-trimethylanilino)benzenecarbothioamide is sourced from PubChem (CID 115368225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).