C11H15FN2O2S2 — CID 113295942
2-fluoro-4-[methyl(2-methylsulfonylethyl)amino]benzenecarbothioamide (PubChem CID 113295942) has the molecular formula C11H15FN2O2S2 and a molecular weight of 290.38 g/mol. Its IUPAC name is 2-fluoro-4-[methyl(2-methylsulfonylethyl)amino]benzenecarbothioamide.
| Compound Name | 2-fluoro-4-[methyl(2-methylsulfonylethyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 113295942 |
| Molecular Formula | C11H15FN2O2S2 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-fluoro-4-[methyl(2-methylsulfonylethyl)amino]benzenecarbothioamide |
| SMILES | CN(CCS(C)(=O)=O)c1ccc(C(N)=S)c(F)c1 |
| InChI | InChI=1S/C11H15FN2O2S2/c1-14(5-6-18(2,15)16)8-3-4-9(11(13)17)10(12)7-8/h3-4,7H,5-6H2,1-2H3,(H2,13,17) |
| InChIKey | WCFSBZNGLCOZIS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|