C13H18BrFN2S — CID 107534775
2-bromo-3-fluoro-4-[methyl(3-methylbutyl)amino]benzenecarbothioamide (PubChem CID 107534775) has the molecular formula C13H18BrFN2S and a molecular weight of 333.27 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[methyl(3-methylbutyl)amino]benzenecarbothioamide.
| Compound Name | 2-bromo-3-fluoro-4-[methyl(3-methylbutyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107534775 |
| Molecular Formula | C13H18BrFN2S |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 2-bromo-3-fluoro-4-[methyl(3-methylbutyl)amino]benzenecarbothioamide |
| SMILES | CC(C)CCN(C)c1ccc(C(N)=S)c(Br)c1F |
| InChI | InChI=1S/C13H18BrFN2S/c1-8(2)6-7-17(3)10-5-4-9(13(16)18)11(14)12(10)15/h4-5,8H,6-7H2,1-3H3,(H2,16,18) |
| InChIKey | IBVBEMTWNDDHKS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|