C14H21BrFN3S — CID 107535474
2-bromo-4-[3-(dimethylamino)propyl-ethylamino]-3-fluorobenzenecarbothioamide (PubChem CID 107535474) has the molecular formula C14H21BrFN3S and a molecular weight of 362.31 g/mol. Its IUPAC name is 2-bromo-4-[3-(dimethylamino)propyl-ethylamino]-3-fluorobenzenecarbothioamide.
| Compound Name | 2-bromo-4-[3-(dimethylamino)propyl-ethylamino]-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107535474 |
| Molecular Formula | C14H21BrFN3S |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 2-bromo-4-[3-(dimethylamino)propyl-ethylamino]-3-fluorobenzenecarbothioamide |
| SMILES | CCN(CCCN(C)C)c1ccc(C(N)=S)c(Br)c1F |
| InChI | InChI=1S/C14H21BrFN3S/c1-4-19(9-5-8-18(2)3)11-7-6-10(14(17)20)12(15)13(11)16/h6-7H,4-5,8-9H2,1-3H3,(H2,17,20) |
| InChIKey | HUMFLCNLABROEX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|